C45H39NO — CID 149287713
N,N-bis(9,9-dimethylfluoren-2-yl)-6-propan-2-yldibenzofuran-4-amine (PubChem CID 149287713) has the molecular formula C45H39NO and a molecular weight of 609.81 g/mol. Its IUPAC name is N,N-bis(9,9-dimethylfluoren-2-yl)-6-propan-2-yldibenzofuran-4-amine.
| Compound Name | N,N-bis(9,9-dimethylfluoren-2-yl)-6-propan-2-yldibenzofuran-4-amine |
|---|---|
| PubChem CID | 149287713 |
| Molecular Formula | C45H39NO |
| Molecular Weight | 609.81 g/mol |
| Exact Mass | 609.30 |
| IUPAC Name | N,N-bis(9,9-dimethylfluoren-2-yl)-6-propan-2-yldibenzofuran-4-amine |
| SMILES | CC(C)c1cccc2c1oc1c(N(c3ccc4c(c3)C(C)(C)c3ccccc3-4)c3ccc4c(c3)C(C)(C)c3ccccc3-4)cccc12 |
| InChI | InChI=1S/C45H39NO/c1-27(2)30-15-11-16-35-36-17-12-20-41(43(36)47-42(30)35)46(28-21-23-33-31-13-7-9-18-37(31)44(3,4)39(33)25-28)29-22-24-34-32-14-8-10-19-38(32)45(5,6)40(34)26-29/h7-27H,1-6H3 |
| InChIKey | XUFPKZVBDRSLNL-UHFFFAOYSA-N |
| XLogP | 12.79 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.81 |
| LogP ≤ 5 | 12.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |