C24H22F3NO — CID 138651769
6-tert-butyl-N-methyl-N-[4-(trifluoromethyl)phenyl]dibenzofuran-4-amine (PubChem CID 138651769) has the molecular formula C24H22F3NO and a molecular weight of 397.44 g/mol. Its IUPAC name is 6-tert-butyl-N-methyl-N-[4-(trifluoromethyl)phenyl]dibenzofuran-4-amine.
| Compound Name | 6-tert-butyl-N-methyl-N-[4-(trifluoromethyl)phenyl]dibenzofuran-4-amine |
|---|---|
| PubChem CID | 138651769 |
| Molecular Formula | C24H22F3NO |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 6-tert-butyl-N-methyl-N-[4-(trifluoromethyl)phenyl]dibenzofuran-4-amine |
| SMILES | CN(c1ccc(C(F)(F)F)cc1)c1cccc2c1oc1c(C(C)(C)C)cccc12 |
| InChI | InChI=1S/C24H22F3NO/c1-23(2,3)19-9-5-7-17-18-8-6-10-20(22(18)29-21(17)19)28(4)16-13-11-15(12-14-16)24(25,26)27/h5-14H,1-4H3 |
| InChIKey | OWRHMRFWWXFJOX-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |