C21H13F3N2O — CID 134527975
6-[N-methyl-2-(trifluoromethyl)anilino]dibenzofuran-4-carbonitrile (PubChem CID 134527975) has the molecular formula C21H13F3N2O and a molecular weight of 366.34 g/mol. Its IUPAC name is 6-[N-methyl-2-(trifluoromethyl)anilino]dibenzofuran-4-carbonitrile.
| Compound Name | 6-[N-methyl-2-(trifluoromethyl)anilino]dibenzofuran-4-carbonitrile |
|---|---|
| PubChem CID | 134527975 |
| Molecular Formula | C21H13F3N2O |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 6-[N-methyl-2-(trifluoromethyl)anilino]dibenzofuran-4-carbonitrile |
| SMILES | CN(c1ccccc1C(F)(F)F)c1cccc2c1oc1c(C#N)cccc12 |
| InChI | InChI=1S/C21H13F3N2O/c1-26(17-10-3-2-9-16(17)21(22,23)24)18-11-5-8-15-14-7-4-6-13(12-25)19(14)27-20(15)18/h2-11H,1H3 |
| InChIKey | NHKYCMGOECHSQI-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 40.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |