C45H40I2N2S2 — CID 137416431
N-(4-ethylphenyl)-N-iodo-9-[5-[iodo-(6-propan-2-yldibenzothiophen-4-yl)amino]-2-methylphenyl]-6-propan-2-yldibenzothiophen-4-amine (PubChem CID 137416431) has the molecular formula C45H40I2N2S2 and a molecular weight of 926.77 g/mol. Its IUPAC name is N-(4-ethylphenyl)-N-iodo-9-[5-[iodo-(6-propan-2-yldibenzothiophen-4-yl)amino]-2-methylphenyl]-6-propan-2-yldibenzothiophen-4-amine.
| Compound Name | N-(4-ethylphenyl)-N-iodo-9-[5-[iodo-(6-propan-2-yldibenzothiophen-4-yl)amino]-2-methylphenyl]-6-propan-2-yldibenzothiophen-4-amine |
|---|---|
| PubChem CID | 137416431 |
| Molecular Formula | C45H40I2N2S2 |
| Molecular Weight | 926.77 g/mol |
| Exact Mass | 926.07 |
| IUPAC Name | N-(4-ethylphenyl)-N-iodo-9-[5-[iodo-(6-propan-2-yldibenzothiophen-4-yl)amino]-2-methylphenyl]-6-propan-2-yldibenzothiophen-4-amine |
| SMILES | CCc1ccc(N(I)c2cccc3c2sc2c(C(C)C)ccc(-c4cc(N(I)c5cccc6c5sc5c(C(C)C)cccc56)ccc4C)c23)cc1 |
| InChI | InChI=1S/C45H40I2N2S2/c1-7-29-18-21-30(22-19-29)48(46)40-16-10-14-37-41-34(24-23-33(27(4)5)45(41)51-44(37)40)38-25-31(20-17-28(38)6)49(47)39-15-9-13-36-35-12-8-11-32(26(2)3)42(35)50-43(36)39/h8-27H,7H2,1-6H3 |
| InChIKey | ZSRZBZZNKYKUKM-UHFFFAOYSA-N |
| XLogP | 16.18 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 926.77 |
| LogP ≤ 5 | 16.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|