C15H17N5O2 — CID 137417579
(2R)-3-[[2-amino-7-(1H-pyrazol-5-yl)quinolin-4-yl]amino]propane-1,2-diol (PubChem CID 137417579) has the molecular formula C15H17N5O2 and a molecular weight of 299.33 g/mol. Its IUPAC name is (2R)-3-[[2-amino-7-(1H-pyrazol-5-yl)quinolin-4-yl]amino]propane-1,2-diol.
| Compound Name | (2R)-3-[[2-amino-7-(1H-pyrazol-5-yl)quinolin-4-yl]amino]propane-1,2-diol |
|---|---|
| PubChem CID | 137417579 |
| Molecular Formula | C15H17N5O2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | (2R)-3-[[2-amino-7-(1H-pyrazol-5-yl)quinolin-4-yl]amino]propane-1,2-diol |
| SMILES | Nc1cc(NC[C@@H](O)CO)c2ccc(-c3ccn[nH]3)cc2n1 |
| InChI | InChI=1S/C15H17N5O2/c16-15-6-13(17-7-10(22)8-21)11-2-1-9(5-14(11)19-15)12-3-4-18-20-12/h1-6,10,21-22H,7-8H2,(H,18,20)(H3,16,17,19)/t10-/m1/s1 |
| InChIKey | GBAOGBKHTMDGNI-SNVBAGLBSA-N |
| XLogP | 0.97 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |