C17H22N8 — CID 142517047
4-N-[2-[amino-[(Z)-2-aminoprop-1-enyl]amino]ethyl]-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine (PubChem CID 142517047) has the molecular formula C17H22N8 and a molecular weight of 338.42 g/mol. Its IUPAC name is 4-N-[2-[amino-[(Z)-2-aminoprop-1-enyl]amino]ethyl]-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine.
| Compound Name | 4-N-[2-[amino-[(Z)-2-aminoprop-1-enyl]amino]ethyl]-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine |
|---|---|
| PubChem CID | 142517047 |
| Molecular Formula | C17H22N8 |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 4-N-[2-[amino-[(Z)-2-aminoprop-1-enyl]amino]ethyl]-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine |
| SMILES | C/C(N)=C/N(N)CCNc1cc(N)nc2cc(-c3ccn[nH]3)ccc12 |
| InChI | InChI=1S/C17H22N8/c1-11(18)10-25(20)7-6-21-15-9-17(19)23-16-8-12(2-3-13(15)16)14-4-5-22-24-14/h2-5,8-10H,6-7,18,20H2,1H3,(H,22,24)(H3,19,21,23)/b11-10- |
| InChIKey | KZNKOTHZPXOJHR-KHPPLWFESA-N |
| XLogP | 1.61 |
| TPSA | 134.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|