C16H19N5O2 — CID 137417584
3-[[2-amino-6-methoxy-7-(1H-pyrazol-5-yl)quinolin-4-yl]amino]propan-1-ol (PubChem CID 137417584) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 3-[[2-amino-6-methoxy-7-(1H-pyrazol-5-yl)quinolin-4-yl]amino]propan-1-ol.
| Compound Name | 3-[[2-amino-6-methoxy-7-(1H-pyrazol-5-yl)quinolin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 137417584 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 3-[[2-amino-6-methoxy-7-(1H-pyrazol-5-yl)quinolin-4-yl]amino]propan-1-ol |
| SMILES | COc1cc2c(NCCCO)cc(N)nc2cc1-c1ccn[nH]1 |
| InChI | InChI=1S/C16H19N5O2/c1-23-15-8-10-13(18-4-2-6-22)9-16(17)20-14(10)7-11(15)12-3-5-19-21-12/h3,5,7-9,22H,2,4,6H2,1H3,(H,19,21)(H3,17,18,20) |
| InChIKey | MVJVNRACZHSXON-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 109.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|