C14H17N5OS — CID 162785002
7-N-(2-methoxyethyl)-3-methyl-2-(1H-pyrazol-5-yl)thieno[3,2-b]pyridine-5,7-diamine (PubChem CID 162785002) has the molecular formula C14H17N5OS and a molecular weight of 303.39 g/mol. Its IUPAC name is 7-N-(2-methoxyethyl)-3-methyl-2-(1H-pyrazol-5-yl)thieno[3,2-b]pyridine-5,7-diamine.
| Compound Name | 7-N-(2-methoxyethyl)-3-methyl-2-(1H-pyrazol-5-yl)thieno[3,2-b]pyridine-5,7-diamine |
|---|---|
| PubChem CID | 162785002 |
| Molecular Formula | C14H17N5OS |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 7-N-(2-methoxyethyl)-3-methyl-2-(1H-pyrazol-5-yl)thieno[3,2-b]pyridine-5,7-diamine |
| SMILES | COCCNc1cc(N)nc2c(C)c(-c3ccn[nH]3)sc12 |
| InChI | InChI=1S/C14H17N5OS/c1-8-12-14(21-13(8)9-3-4-17-19-9)10(7-11(15)18-12)16-5-6-20-2/h3-4,7H,5-6H2,1-2H3,(H,17,19)(H3,15,16,18) |
| InChIKey | FSQRTMLIQTXPSE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|