C17H22N6OS — CID 162784975
N-[3-[[5-amino-3-methyl-2-(1H-pyrazol-5-yl)thieno[3,2-b]pyridin-7-yl]amino]propyl]-N-methylacetamide (PubChem CID 162784975) has the molecular formula C17H22N6OS and a molecular weight of 358.47 g/mol. Its IUPAC name is N-[3-[[5-amino-3-methyl-2-(1H-pyrazol-5-yl)thieno[3,2-b]pyridin-7-yl]amino]propyl]-N-methylacetamide.
| Compound Name | N-[3-[[5-amino-3-methyl-2-(1H-pyrazol-5-yl)thieno[3,2-b]pyridin-7-yl]amino]propyl]-N-methylacetamide |
|---|---|
| PubChem CID | 162784975 |
| Molecular Formula | C17H22N6OS |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | N-[3-[[5-amino-3-methyl-2-(1H-pyrazol-5-yl)thieno[3,2-b]pyridin-7-yl]amino]propyl]-N-methylacetamide |
| SMILES | CC(=O)N(C)CCCNc1cc(N)nc2c(C)c(-c3ccn[nH]3)sc12 |
| InChI | InChI=1S/C17H22N6OS/c1-10-15-17(25-16(10)12-5-7-20-22-12)13(9-14(18)21-15)19-6-4-8-23(3)11(2)24/h5,7,9H,4,6,8H2,1-3H3,(H,20,22)(H3,18,19,21) |
| InChIKey | MWQRGKIUAMEWPA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|