About 6-propan-2-yl-5,7-dihydropyrrolo[3,4-b]pyridin-4-amine
6-propan-2-yl-5,7-dihydropyrrolo[3,4-b]pyridin-4-amine (PubChem CID 137417876) has the molecular formula C10H15N3
and a molecular weight of 177.25 g/mol. Its IUPAC name is 6-propan-2-yl-5,7-dihydropyrrolo[3,4-b]pyridin-4-amine.
Molecular Properties
| Compound Name | 6-propan-2-yl-5,7-dihydropyrrolo[3,4-b]pyridin-4-amine |
| PubChem CID | 137417876 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 6-propan-2-yl-5,7-dihydropyrrolo[3,4-b]pyridin-4-amine |
| SMILES | CC(C)N1Cc2nccc(N)c2C1 |
| InChI | InChI=1S/C10H15N3/c1-7(2)13-5-8-9(11)3-4-12-10(8)6-13/h3-4,7H,5-6H2,1-2H3,(H2,11,12) |
| InChIKey | PNIURNASLLJUNK-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-propan-2-yl-5,7-dihydropyrrolo[3,4-b]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propan-2-yl-5,7-dihydropyrrolo[3,4-b]pyridin-4-amine?
The IUPAC name of 6-propan-2-yl-5,7-dihydropyrrolo[3,4-b]pyridin-4-amine (CID 137417876) is 6-propan-2-yl-5,7-dihydropyrrolo[3,4-b]pyridin-4-amine.
What is the SMILES notation for 6-propan-2-yl-5,7-dihydropyrrolo[3,4-b]pyridin-4-amine?
The canonical SMILES for 6-propan-2-yl-5,7-dihydropyrrolo[3,4-b]pyridin-4-amine is CC(C)N1Cc2nccc(N)c2C1.
What is the InChIKey of 6-propan-2-yl-5,7-dihydropyrrolo[3,4-b]pyridin-4-amine?
The InChIKey is PNIURNASLLJUNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3/c1-7(2)13-5-8-9(11)3-4-12-10(8)6-13/h3-4,7H,5-6H2,1-2H3,(H2,11,12).
What are the key properties of 6-propan-2-yl-5,7-dihydropyrrolo[3,4-b]pyridin-4-amine?
6-propan-2-yl-5,7-dihydropyrrolo[3,4-b]pyridin-4-amine has a molecular weight of 177.25 g/mol, XLogP of 1.39, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propan-2-yl-5,7-dihydropyrrolo[3,4-b]pyridin-4-amine is sourced from PubChem (CID 137417876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).