C25H27N9O2 — CID 137421154
N-[5-[[4-(benzotriazol-1-yl)pyrimidin-2-yl]amino]-2-[2-(dimethylamino)ethyl-methylamino]-4-formylphenyl]prop-2-enamide (PubChem CID 137421154) has the molecular formula C25H27N9O2 and a molecular weight of 485.55 g/mol. Its IUPAC name is N-[5-[[4-(benzotriazol-1-yl)pyrimidin-2-yl]amino]-2-[2-(dimethylamino)ethyl-methylamino]-4-formylphenyl]prop-2-enamide.
| Compound Name | N-[5-[[4-(benzotriazol-1-yl)pyrimidin-2-yl]amino]-2-[2-(dimethylamino)ethyl-methylamino]-4-formylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 137421154 |
| Molecular Formula | C25H27N9O2 |
| Molecular Weight | 485.55 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | N-[5-[[4-(benzotriazol-1-yl)pyrimidin-2-yl]amino]-2-[2-(dimethylamino)ethyl-methylamino]-4-formylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2nccc(-n3nnc4ccccc43)n2)c(C=O)cc1N(C)CCN(C)C |
| InChI | InChI=1S/C25H27N9O2/c1-5-24(36)27-20-15-19(17(16-35)14-22(20)33(4)13-12-32(2)3)28-25-26-11-10-23(29-25)34-21-9-7-6-8-18(21)30-31-34/h5-11,14-16H,1,12-13H2,2-4H3,(H,27,36)(H,26,28,29) |
| InChIKey | XTPRTESAZTWTRR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 121.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.55 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|