C39H29N3S — CID 137421297
[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-triphenyl-λ4-sulfane (PubChem CID 137421297) has the molecular formula C39H29N3S and a molecular weight of 571.75 g/mol. Its IUPAC name is [3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-triphenyl-λ4-sulfane.
| Compound Name | [3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-triphenyl-λ4-sulfane |
|---|---|
| PubChem CID | 137421297 |
| Molecular Formula | C39H29N3S |
| Molecular Weight | 571.75 g/mol |
| Exact Mass | 571.21 |
| IUPAC Name | [3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-triphenyl-λ4-sulfane |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(S(c4ccccc4)(c4ccccc4)c4ccccc4)c3)n2)cc1 |
| InChI | InChI=1S/C39H29N3S/c1-6-17-30(18-7-1)37-40-38(31-19-8-2-9-20-31)42-39(41-37)32-21-16-28-36(29-32)43(33-22-10-3-11-23-33,34-24-12-4-13-25-34)35-26-14-5-15-27-35/h1-29H |
| InChIKey | CUTHHMOEGIJKOB-UHFFFAOYSA-N |
| XLogP | 10.21 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.75 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |