C45H33N3S — CID 170245167
triphenyl-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-λ4-sulfane (PubChem CID 170245167) has the molecular formula C45H33N3S and a molecular weight of 647.85 g/mol. Its IUPAC name is triphenyl-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-λ4-sulfane.
| Compound Name | triphenyl-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-λ4-sulfane |
|---|---|
| PubChem CID | 170245167 |
| Molecular Formula | C45H33N3S |
| Molecular Weight | 647.85 g/mol |
| Exact Mass | 647.24 |
| IUPAC Name | triphenyl-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-λ4-sulfane |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccc(S(c5ccccc5)(c5ccccc5)c5ccccc5)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C45H33N3S/c1-6-16-34(17-7-1)35-26-28-37(29-27-35)44-46-43(36-18-8-2-9-19-36)47-45(48-44)38-30-32-42(33-31-38)49(39-20-10-3-11-21-39,40-22-12-4-13-23-40)41-24-14-5-15-25-41/h1-33H |
| InChIKey | KNROUYURCZLYCH-UHFFFAOYSA-N |
| XLogP | 11.88 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.85 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |