C16H20FNO3 — CID 137422493
ethyl 4-[(4-fluoro-4-formylpiperidin-1-yl)methyl]benzoate (PubChem CID 137422493) has the molecular formula C16H20FNO3 and a molecular weight of 293.34 g/mol. Its IUPAC name is ethyl 4-[(4-fluoro-4-formylpiperidin-1-yl)methyl]benzoate.
| Compound Name | ethyl 4-[(4-fluoro-4-formylpiperidin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 137422493 |
| Molecular Formula | C16H20FNO3 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | ethyl 4-[(4-fluoro-4-formylpiperidin-1-yl)methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CN2CCC(F)(C=O)CC2)cc1 |
| InChI | InChI=1S/C16H20FNO3/c1-2-21-15(20)14-5-3-13(4-6-14)11-18-9-7-16(17,12-19)8-10-18/h3-6,12H,2,7-11H2,1H3 |
| InChIKey | VDCBGISGLWOMPI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|