C54H58F2N6O6 — CID 137423638
(2R)-1,2-bis(1,3-benzodioxol-5-yl)-N,N'-bis[[1-[2-(2-fluorophenoxy)ethyl]piperidin-4-yl]methyl]-1,2-dipyridin-2-ylethane-1,2-diamine (PubChem CID 137423638) has the molecular formula C54H58F2N6O6 and a molecular weight of 925.09 g/mol. Its IUPAC name is (2R)-1,2-bis(1,3-benzodioxol-5-yl)-N,N'-bis[[1-[2-(2-fluorophenoxy)ethyl]piperidin-4-yl]methyl]-1,2-dipyridin-2-ylethane-1,2-diamine.
| Compound Name | (2R)-1,2-bis(1,3-benzodioxol-5-yl)-N,N'-bis[[1-[2-(2-fluorophenoxy)ethyl]piperidin-4-yl]methyl]-1,2-dipyridin-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 137423638 |
| Molecular Formula | C54H58F2N6O6 |
| Molecular Weight | 925.09 g/mol |
| Exact Mass | 924.44 |
| IUPAC Name | (2R)-1,2-bis(1,3-benzodioxol-5-yl)-N,N'-bis[[1-[2-(2-fluorophenoxy)ethyl]piperidin-4-yl]methyl]-1,2-dipyridin-2-ylethane-1,2-diamine |
| SMILES | Fc1ccccc1OCCN1CCC(CNC(c2ccc3c(c2)OCO3)(c2ccccn2)[C@](NCC2CCN(CCOc3ccccc3F)CC2)(c2ccc3c(c2)OCO3)c2ccccn2)CC1 |
| InChI | InChI=1S/C54H58F2N6O6/c55-43-9-1-3-11-45(43)63-31-29-61-25-19-39(20-26-61)35-59-53(51-13-5-7-23-57-51,41-15-17-47-49(33-41)67-37-65-47)54(52-14-6-8-24-58-52,42-16-18-48-50(34-42)68-38-66-48)60-36-40-21-27-62(28-22-40)30-32-64-46-12-4-2-10-44(46)56/h1-18,23-24,33-34,39-40,59-60H,19-22,25-32,35-38H2/t53-,54?/m0/s1 |
| InChIKey | JJDGEMVNPHQCQJ-AVRFZLNTSA-N |
| XLogP | 8.16 |
| TPSA | 111.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 925.09 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |