C17H14FNO3 — CID 82137622
2-(1,3-benzodioxol-5-yl)-4-(2-fluorophenoxy)butanenitrile (PubChem CID 82137622) has the molecular formula C17H14FNO3 and a molecular weight of 299.30 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-4-(2-fluorophenoxy)butanenitrile.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-4-(2-fluorophenoxy)butanenitrile |
|---|---|
| PubChem CID | 82137622 |
| Molecular Formula | C17H14FNO3 |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-4-(2-fluorophenoxy)butanenitrile |
| SMILES | N#CC(CCOc1ccccc1F)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H14FNO3/c18-14-3-1-2-4-15(14)20-8-7-13(10-19)12-5-6-16-17(9-12)22-11-21-16/h1-6,9,13H,7-8,11H2 |
| InChIKey | GUCOWWZFUVQUCK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |