C19H21FN2O4 — CID 51565515
(2S)-N-(1,3-benzodioxol-5-ylmethyl)-2-[2-(2-fluorophenoxy)ethylamino]propanamide (PubChem CID 51565515) has the molecular formula C19H21FN2O4 and a molecular weight of 360.39 g/mol. Its IUPAC name is (2S)-N-(1,3-benzodioxol-5-ylmethyl)-2-[2-(2-fluorophenoxy)ethylamino]propanamide.
| Compound Name | (2S)-N-(1,3-benzodioxol-5-ylmethyl)-2-[2-(2-fluorophenoxy)ethylamino]propanamide |
|---|---|
| PubChem CID | 51565515 |
| Molecular Formula | C19H21FN2O4 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | (2S)-N-(1,3-benzodioxol-5-ylmethyl)-2-[2-(2-fluorophenoxy)ethylamino]propanamide |
| SMILES | C[C@H](NCCOc1ccccc1F)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H21FN2O4/c1-13(21-8-9-24-16-5-3-2-4-15(16)20)19(23)22-11-14-6-7-17-18(10-14)26-12-25-17/h2-7,10,13,21H,8-9,11-12H2,1H3,(H,22,23)/t13-/m0/s1 |
| InChIKey | STOYTLOLEISKSW-ZDUSSCGKSA-N |
| XLogP | 2.23 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|