C18H16FNO5 — CID 66924481
2-[1-(1,3-benzodioxol-5-yl)-2-(methoxymethoxy)ethoxy]-6-fluorobenzonitrile (PubChem CID 66924481) has the molecular formula C18H16FNO5 and a molecular weight of 345.33 g/mol. Its IUPAC name is 2-[1-(1,3-benzodioxol-5-yl)-2-(methoxymethoxy)ethoxy]-6-fluorobenzonitrile.
| Compound Name | 2-[1-(1,3-benzodioxol-5-yl)-2-(methoxymethoxy)ethoxy]-6-fluorobenzonitrile |
|---|---|
| PubChem CID | 66924481 |
| Molecular Formula | C18H16FNO5 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 2-[1-(1,3-benzodioxol-5-yl)-2-(methoxymethoxy)ethoxy]-6-fluorobenzonitrile |
| SMILES | COCOCC(Oc1cccc(F)c1C#N)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H16FNO5/c1-21-10-22-9-18(12-5-6-16-17(7-12)24-11-23-16)25-15-4-2-3-14(19)13(15)8-20/h2-7,18H,9-11H2,1H3 |
| InChIKey | MYPCZNNJEAJNAU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 69.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|