C21H12ClN3O — CID 137424596
2-chloro-3-(4-pyridin-2-ylphenyl)-[1]benzofuro[2,3-b]pyrazine (PubChem CID 137424596) has the molecular formula C21H12ClN3O and a molecular weight of 357.80 g/mol. Its IUPAC name is 2-chloro-3-(4-pyridin-2-ylphenyl)-[1]benzofuro[2,3-b]pyrazine.
| Compound Name | 2-chloro-3-(4-pyridin-2-ylphenyl)-[1]benzofuro[2,3-b]pyrazine |
|---|---|
| PubChem CID | 137424596 |
| Molecular Formula | C21H12ClN3O |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 2-chloro-3-(4-pyridin-2-ylphenyl)-[1]benzofuro[2,3-b]pyrazine |
| SMILES | Clc1nc2c(nc1-c1ccc(-c3ccccn3)cc1)oc1ccccc12 |
| InChI | InChI=1S/C21H12ClN3O/c22-20-18(14-10-8-13(9-11-14)16-6-3-4-12-23-16)25-21-19(24-20)15-5-1-2-7-17(15)26-21/h1-12H |
| InChIKey | JMAPBGFIUHGQFX-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |