C20H18N2O — CID 167353771
2-tert-butyl-3-phenyl-[1]benzofuro[2,3-b]pyrazine (PubChem CID 167353771) has the molecular formula C20H18N2O and a molecular weight of 302.38 g/mol. Its IUPAC name is 2-tert-butyl-3-phenyl-[1]benzofuro[2,3-b]pyrazine.
| Compound Name | 2-tert-butyl-3-phenyl-[1]benzofuro[2,3-b]pyrazine |
|---|---|
| PubChem CID | 167353771 |
| Molecular Formula | C20H18N2O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 2-tert-butyl-3-phenyl-[1]benzofuro[2,3-b]pyrazine |
| SMILES | CC(C)(C)c1nc2c(nc1-c1ccccc1)oc1ccccc12 |
| InChI | InChI=1S/C20H18N2O/c1-20(2,3)18-16(13-9-5-4-6-10-13)22-19-17(21-18)14-11-7-8-12-15(14)23-19/h4-12H,1-3H3 |
| InChIKey | QFOUMXAFYMFZGZ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |