C16H9ClN2O — CID 118543898
2-chloro-4-phenyl-[1]benzofuro[2,3-d]pyrimidine (PubChem CID 118543898) has the molecular formula C16H9ClN2O and a molecular weight of 280.71 g/mol. Its IUPAC name is 2-chloro-4-phenyl-[1]benzofuro[2,3-d]pyrimidine.
| Compound Name | 2-chloro-4-phenyl-[1]benzofuro[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 118543898 |
| Molecular Formula | C16H9ClN2O |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 2-chloro-4-phenyl-[1]benzofuro[2,3-d]pyrimidine |
| SMILES | Clc1nc(-c2ccccc2)c2c(n1)oc1ccccc12 |
| InChI | InChI=1S/C16H9ClN2O/c17-16-18-14(10-6-2-1-3-7-10)13-11-8-4-5-9-12(11)20-15(13)19-16/h1-9H |
| InChIKey | LUUGUZVTJFKCAD-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |