C16H10BN2O3 — CID 164839359
CID 164839359 (PubChem CID 164839359) has the molecular formula C16H10BN2O3 and a molecular weight of 289.08 g/mol.
| Compound Name | CID 164839359 |
|---|---|
| PubChem CID | 164839359 |
| Molecular Formula | C16H10BN2O3 |
| Molecular Weight | 289.08 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | — |
| SMILES | O[B]Oc1nc(-c2ccccc2)c2c(n1)oc1ccccc12 |
| InChI | InChI=1S/C16H10BN2O3/c20-17-22-16-18-14(10-6-2-1-3-7-10)13-11-8-4-5-9-12(11)21-15(13)19-16/h1-9,20H |
| InChIKey | RQYJIYWKHSSWST-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.08 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|