C18H14N2O — CID 142487813
2-ethyl-4-phenyl-[1]benzofuro[2,3-d]pyrimidine (PubChem CID 142487813) has the molecular formula C18H14N2O and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-ethyl-4-phenyl-[1]benzofuro[2,3-d]pyrimidine.
| Compound Name | 2-ethyl-4-phenyl-[1]benzofuro[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 142487813 |
| Molecular Formula | C18H14N2O |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2-ethyl-4-phenyl-[1]benzofuro[2,3-d]pyrimidine |
| SMILES | CCc1nc(-c2ccccc2)c2c(n1)oc1ccccc12 |
| InChI | InChI=1S/C18H14N2O/c1-2-15-19-17(12-8-4-3-5-9-12)16-13-10-6-7-11-14(13)21-18(16)20-15/h3-11H,2H2,1H3 |
| InChIKey | MLOVXTIAMUKTST-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |