C31H27F3N6O — CID 137426044
(11R,15S)-5-anilino-8-methyl-3-[[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),4,9-trien-7-one (PubChem CID 137426044) has the molecular formula C31H27F3N6O and a molecular weight of 556.59 g/mol. Its IUPAC name is (11R,15S)-5-anilino-8-methyl-3-[[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),4,9-trien-7-one.
| Compound Name | (11R,15S)-5-anilino-8-methyl-3-[[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),4,9-trien-7-one |
|---|---|
| PubChem CID | 137426044 |
| Molecular Formula | C31H27F3N6O |
| Molecular Weight | 556.59 g/mol |
| Exact Mass | 556.22 |
| IUPAC Name | (11R,15S)-5-anilino-8-methyl-3-[[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),4,9-trien-7-one |
| SMILES | CN1C(=O)c2c(Nc3ccccc3)nn(Cc3ccc(-c4ccc(C(F)(F)F)cc4)cc3)c2N2C1=N[C@@H]1CCC[C@@H]12 |
| InChI | InChI=1S/C31H27F3N6O/c1-38-29(41)26-27(35-23-6-3-2-4-7-23)37-39(28(26)40-25-9-5-8-24(25)36-30(38)40)18-19-10-12-20(13-11-19)21-14-16-22(17-15-21)31(32,33)34/h2-4,6-7,10-17,24-25H,5,8-9,18H2,1H3,(H,35,37)/t24-,25+/m1/s1 |
| InChIKey | JDVUJUZWSQOOHK-RPBOFIJWSA-N |
| XLogP | 6.54 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.59 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |