C27H34N4O2S — CID 137426845
2-amino-8-[3-[3-(hydroxymethyl)azetidin-1-yl]sulfanylphenyl]-N,N-dipropyl-3H-1-benzazepine-4-carboxamide (PubChem CID 137426845) has the molecular formula C27H34N4O2S and a molecular weight of 478.66 g/mol. Its IUPAC name is 2-amino-8-[3-[3-(hydroxymethyl)azetidin-1-yl]sulfanylphenyl]-N,N-dipropyl-3H-1-benzazepine-4-carboxamide.
| Compound Name | 2-amino-8-[3-[3-(hydroxymethyl)azetidin-1-yl]sulfanylphenyl]-N,N-dipropyl-3H-1-benzazepine-4-carboxamide |
|---|---|
| PubChem CID | 137426845 |
| Molecular Formula | C27H34N4O2S |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | 2-amino-8-[3-[3-(hydroxymethyl)azetidin-1-yl]sulfanylphenyl]-N,N-dipropyl-3H-1-benzazepine-4-carboxamide |
| SMILES | CCCN(CCC)C(=O)C1=Cc2ccc(-c3cccc(SN4CC(CO)C4)c3)cc2N=C(N)C1 |
| InChI | InChI=1S/C27H34N4O2S/c1-3-10-30(11-4-2)27(33)23-12-22-9-8-21(14-25(22)29-26(28)15-23)20-6-5-7-24(13-20)34-31-16-19(17-31)18-32/h5-9,12-14,19,32H,3-4,10-11,15-18H2,1-2H3,(H2,28,29) |
| InChIKey | DVBGDKPQXLXRJV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|