C23H28N4OS — CID 155406701
2-amino-N-(3-aminopropyl)-N-propyl-8-(3-sulfanylphenyl)-3H-1-benzazepine-4-carboxamide (PubChem CID 155406701) has the molecular formula C23H28N4OS and a molecular weight of 408.57 g/mol. Its IUPAC name is 2-amino-N-(3-aminopropyl)-N-propyl-8-(3-sulfanylphenyl)-3H-1-benzazepine-4-carboxamide.
| Compound Name | 2-amino-N-(3-aminopropyl)-N-propyl-8-(3-sulfanylphenyl)-3H-1-benzazepine-4-carboxamide |
|---|---|
| PubChem CID | 155406701 |
| Molecular Formula | C23H28N4OS |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 2-amino-N-(3-aminopropyl)-N-propyl-8-(3-sulfanylphenyl)-3H-1-benzazepine-4-carboxamide |
| SMILES | CCCN(CCCN)C(=O)C1=Cc2ccc(-c3cccc(S)c3)cc2N=C(N)C1 |
| InChI | InChI=1S/C23H28N4OS/c1-2-10-27(11-4-9-24)23(28)19-12-18-8-7-17(14-21(18)26-22(25)15-19)16-5-3-6-20(29)13-16/h3,5-8,12-14,29H,2,4,9-11,15,24H2,1H3,(H2,25,26) |
| InChIKey | QHHHLHWCEJCBNS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|