C22H26N6O3 — CID 174186549
3-[(2-amino-8-pyrimidin-5-yl-3H-1-benzazepine-4-carbonyl)-propylamino]propylcarbamic acid (PubChem CID 174186549) has the molecular formula C22H26N6O3 and a molecular weight of 422.49 g/mol. Its IUPAC name is 3-[(2-amino-8-pyrimidin-5-yl-3H-1-benzazepine-4-carbonyl)-propylamino]propylcarbamic acid.
| Compound Name | 3-[(2-amino-8-pyrimidin-5-yl-3H-1-benzazepine-4-carbonyl)-propylamino]propylcarbamic acid |
|---|---|
| PubChem CID | 174186549 |
| Molecular Formula | C22H26N6O3 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 3-[(2-amino-8-pyrimidin-5-yl-3H-1-benzazepine-4-carbonyl)-propylamino]propylcarbamic acid |
| SMILES | CCCN(CCCNC(=O)O)C(=O)C1=Cc2ccc(-c3cncnc3)cc2N=C(N)C1 |
| InChI | InChI=1S/C22H26N6O3/c1-2-7-28(8-3-6-26-22(30)31)21(29)17-9-16-5-4-15(18-12-24-14-25-13-18)10-19(16)27-20(23)11-17/h4-5,9-10,12-14,26H,2-3,6-8,11H2,1H3,(H2,23,27)(H,30,31) |
| InChIKey | FMZSAXZQDXKCSP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 133.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|