C28H37N5O2 — CID 122523748
2-amino-8-N-[3-(4-aminobutyl)phenyl]-4-N,4-N-dipropyl-3H-1-benzazepine-4,8-dicarboxamide (PubChem CID 122523748) has the molecular formula C28H37N5O2 and a molecular weight of 475.64 g/mol. Its IUPAC name is 2-amino-8-N-[3-(4-aminobutyl)phenyl]-4-N,4-N-dipropyl-3H-1-benzazepine-4,8-dicarboxamide.
| Compound Name | 2-amino-8-N-[3-(4-aminobutyl)phenyl]-4-N,4-N-dipropyl-3H-1-benzazepine-4,8-dicarboxamide |
|---|---|
| PubChem CID | 122523748 |
| Molecular Formula | C28H37N5O2 |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.29 |
| IUPAC Name | 2-amino-8-N-[3-(4-aminobutyl)phenyl]-4-N,4-N-dipropyl-3H-1-benzazepine-4,8-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)C1=Cc2ccc(C(=O)Nc3cccc(CCCCN)c3)cc2N=C(N)C1 |
| InChI | InChI=1S/C28H37N5O2/c1-3-14-33(15-4-2)28(35)23-17-21-11-12-22(18-25(21)32-26(30)19-23)27(34)31-24-10-7-9-20(16-24)8-5-6-13-29/h7,9-12,16-18H,3-6,8,13-15,19,29H2,1-2H3,(H2,30,32)(H,31,34) |
| InChIKey | LOFKWVOYEQTEKD-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|