C26H32N4O2 — CID 122510276
2-amino-8-N-(3-ethylphenyl)-4-N,4-N-dipropyl-3H-1-benzazepine-4,8-dicarboxamide (PubChem CID 122510276) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 2-amino-8-N-(3-ethylphenyl)-4-N,4-N-dipropyl-3H-1-benzazepine-4,8-dicarboxamide.
| Compound Name | 2-amino-8-N-(3-ethylphenyl)-4-N,4-N-dipropyl-3H-1-benzazepine-4,8-dicarboxamide |
|---|---|
| PubChem CID | 122510276 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 2-amino-8-N-(3-ethylphenyl)-4-N,4-N-dipropyl-3H-1-benzazepine-4,8-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)C1=Cc2ccc(C(=O)Nc3cccc(CC)c3)cc2N=C(N)C1 |
| InChI | InChI=1S/C26H32N4O2/c1-4-12-30(13-5-2)26(32)21-15-19-10-11-20(16-23(19)29-24(27)17-21)25(31)28-22-9-7-8-18(6-3)14-22/h7-11,14-16H,4-6,12-13,17H2,1-3H3,(H2,27,29)(H,28,31) |
| InChIKey | DYOVEWKCVKBSJR-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |