C26H31N5O3 — CID 142430736
2-amino-8-N-[3-(formamidomethyl)phenyl]-4-N,4-N-dipropyl-3H-1-benzazepine-4,8-dicarboxamide (PubChem CID 142430736) has the molecular formula C26H31N5O3 and a molecular weight of 461.57 g/mol. Its IUPAC name is 2-amino-8-N-[3-(formamidomethyl)phenyl]-4-N,4-N-dipropyl-3H-1-benzazepine-4,8-dicarboxamide.
| Compound Name | 2-amino-8-N-[3-(formamidomethyl)phenyl]-4-N,4-N-dipropyl-3H-1-benzazepine-4,8-dicarboxamide |
|---|---|
| PubChem CID | 142430736 |
| Molecular Formula | C26H31N5O3 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | 2-amino-8-N-[3-(formamidomethyl)phenyl]-4-N,4-N-dipropyl-3H-1-benzazepine-4,8-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)C1=Cc2ccc(C(=O)Nc3cccc(CNC=O)c3)cc2N=C(N)C1 |
| InChI | InChI=1S/C26H31N5O3/c1-3-10-31(11-4-2)26(34)21-13-19-8-9-20(14-23(19)30-24(27)15-21)25(33)29-22-7-5-6-18(12-22)16-28-17-32/h5-9,12-14,17H,3-4,10-11,15-16H2,1-2H3,(H2,27,30)(H,28,32)(H,29,33) |
| InChIKey | KHHGYZZBZIHSTC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|