About N-(2-chlorophenyl)-N'-heptan-4-ylmethanediamine
N-(2-chlorophenyl)-N'-heptan-4-ylmethanediamine (PubChem CID 137427135) has the molecular formula C14H23ClN2
and a molecular weight of 254.80 g/mol. Its IUPAC name is N-(2-chlorophenyl)-N'-heptan-4-ylmethanediamine.
Molecular Properties
| Compound Name | N-(2-chlorophenyl)-N'-heptan-4-ylmethanediamine |
| PubChem CID | 137427135 |
| Molecular Formula | C14H23ClN2 |
| Molecular Weight | 254.80 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | N-(2-chlorophenyl)-N'-heptan-4-ylmethanediamine |
| SMILES | CCCC(CCC)NCNc1ccccc1Cl |
| InChI | InChI=1S/C14H23ClN2/c1-3-7-12(8-4-2)16-11-17-14-10-6-5-9-13(14)15/h5-6,9-10,12,16-17H,3-4,7-8,11H2,1-2H3 |
| InChIKey | NBXBHIDUDOYTMC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.80 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(2-chlorophenyl)-N'-heptan-4-ylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chlorophenyl)-N'-heptan-4-ylmethanediamine?
The IUPAC name of N-(2-chlorophenyl)-N'-heptan-4-ylmethanediamine (CID 137427135) is N-(2-chlorophenyl)-N'-heptan-4-ylmethanediamine.
What is the SMILES notation for N-(2-chlorophenyl)-N'-heptan-4-ylmethanediamine?
The canonical SMILES for N-(2-chlorophenyl)-N'-heptan-4-ylmethanediamine is CCCC(CCC)NCNc1ccccc1Cl.
What is the InChIKey of N-(2-chlorophenyl)-N'-heptan-4-ylmethanediamine?
The InChIKey is NBXBHIDUDOYTMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23ClN2/c1-3-7-12(8-4-2)16-11-17-14-10-6-5-9-13(14)15/h5-6,9-10,12,16-17H,3-4,7-8,11H2,1-2H3.
What are the key properties of N-(2-chlorophenyl)-N'-heptan-4-ylmethanediamine?
N-(2-chlorophenyl)-N'-heptan-4-ylmethanediamine has a molecular weight of 254.80 g/mol, XLogP of 4.27, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chlorophenyl)-N'-heptan-4-ylmethanediamine is sourced from PubChem (CID 137427135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).