C10H15ClN2 — CID 65377716
2-N-(2-chlorophenyl)butane-1,2-diamine (PubChem CID 65377716) has the molecular formula C10H15ClN2 and a molecular weight of 198.70 g/mol. Its IUPAC name is 2-N-(2-chlorophenyl)butane-1,2-diamine.
| Compound Name | 2-N-(2-chlorophenyl)butane-1,2-diamine |
|---|---|
| PubChem CID | 65377716 |
| Molecular Formula | C10H15ClN2 |
| Molecular Weight | 198.70 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 2-N-(2-chlorophenyl)butane-1,2-diamine |
| SMILES | CCC(CN)Nc1ccccc1Cl |
| InChI | InChI=1S/C10H15ClN2/c1-2-8(7-12)13-10-6-4-3-5-9(10)11/h3-6,8,13H,2,7,12H2,1H3 |
| InChIKey | HLKCKNDZOQQOJZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.70 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |