C13H21ClN2 — CID 65377307
2-N-(2-chlorophenyl)-3-ethylpentane-1,2-diamine (PubChem CID 65377307) has the molecular formula C13H21ClN2 and a molecular weight of 240.78 g/mol. Its IUPAC name is 2-N-(2-chlorophenyl)-3-ethylpentane-1,2-diamine.
| Compound Name | 2-N-(2-chlorophenyl)-3-ethylpentane-1,2-diamine |
|---|---|
| PubChem CID | 65377307 |
| Molecular Formula | C13H21ClN2 |
| Molecular Weight | 240.78 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 2-N-(2-chlorophenyl)-3-ethylpentane-1,2-diamine |
| SMILES | CCC(CC)C(CN)Nc1ccccc1Cl |
| InChI | InChI=1S/C13H21ClN2/c1-3-10(4-2)13(9-15)16-12-8-6-5-7-11(12)14/h5-8,10,13,16H,3-4,9,15H2,1-2H3 |
| InChIKey | HAKRHLPKCUZRCW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.78 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |