About 2,4,6-trifluoro-4-methylcyclohexa-1,5-dien-1-amine
2,4,6-trifluoro-4-methylcyclohexa-1,5-dien-1-amine (PubChem CID 137427443) has the molecular formula C7H8F3N
and a molecular weight of 163.14 g/mol. Its IUPAC name is 2,4,6-trifluoro-4-methylcyclohexa-1,5-dien-1-amine.
Analyze 2,4,6-trifluoro-4-methylcyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,6-trifluoro-4-methylcyclohexa-1,5-dien-1-amine?
The IUPAC name of 2,4,6-trifluoro-4-methylcyclohexa-1,5-dien-1-amine (CID 137427443) is 2,4,6-trifluoro-4-methylcyclohexa-1,5-dien-1-amine.
What is the SMILES notation for 2,4,6-trifluoro-4-methylcyclohexa-1,5-dien-1-amine?
The canonical SMILES for 2,4,6-trifluoro-4-methylcyclohexa-1,5-dien-1-amine is CC1(F)C=C(F)C(N)=C(F)C1.
What is the InChIKey of 2,4,6-trifluoro-4-methylcyclohexa-1,5-dien-1-amine?
The InChIKey is VJKOAQVOFHVLNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F3N/c1-7(10)2-4(8)6(11)5(9)3-7/h2H,3,11H2,1H3.
What are the key properties of 2,4,6-trifluoro-4-methylcyclohexa-1,5-dien-1-amine?
2,4,6-trifluoro-4-methylcyclohexa-1,5-dien-1-amine has a molecular weight of 163.14 g/mol, XLogP of 2.11, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,6-trifluoro-4-methylcyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 137427443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).