C10H17NO — CID 137427593
(2E,4E)-3-methoxy-7-methylocta-2,4,6-trien-4-amine (PubChem CID 137427593) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is (2E,4E)-3-methoxy-7-methylocta-2,4,6-trien-4-amine.
| Compound Name | (2E,4E)-3-methoxy-7-methylocta-2,4,6-trien-4-amine |
|---|---|
| PubChem CID | 137427593 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (2E,4E)-3-methoxy-7-methylocta-2,4,6-trien-4-amine |
| SMILES | C/C=C(OC)\C(N)=C/C=C(C)C |
| InChI | InChI=1S/C10H17NO/c1-5-10(12-4)9(11)7-6-8(2)3/h5-7H,11H2,1-4H3/b9-7+,10-5+ |
| InChIKey | HCIFFNAPCFTVAD-JCVPOOLXSA-N |
| XLogP | 2.35 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|