C25H17ClN8O — CID 137430297
1-[5-(7-chloro-1H-indazol-5-yl)-3-cyano-6-phenylpyrazin-2-yl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 137430297) has the molecular formula C25H17ClN8O and a molecular weight of 480.92 g/mol. Its IUPAC name is 1-[5-(7-chloro-1H-indazol-5-yl)-3-cyano-6-phenylpyrazin-2-yl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[5-(7-chloro-1H-indazol-5-yl)-3-cyano-6-phenylpyrazin-2-yl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 137430297 |
| Molecular Formula | C25H17ClN8O |
| Molecular Weight | 480.92 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 1-[5-(7-chloro-1H-indazol-5-yl)-3-cyano-6-phenylpyrazin-2-yl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | N#Cc1nc(-c2cc(Cl)c3[nH]ncc3c2)c(-c2ccccc2)nc1NC(=O)NCc1cccnc1 |
| InChI | InChI=1S/C25H17ClN8O/c26-19-10-17(9-18-14-30-34-21(18)19)23-22(16-6-2-1-3-7-16)32-24(20(11-27)31-23)33-25(35)29-13-15-5-4-8-28-12-15/h1-10,12,14H,13H2,(H,30,34)(H2,29,32,33,35) |
| InChIKey | MNDLATNNRPCJRM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 132.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.92 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |