C24H24ClN5S — CID 137430405
5-(8-chloroquinolin-6-yl)-3-(diethylaminomethylsulfanyl)-6-phenylpyrazin-2-amine (PubChem CID 137430405) has the molecular formula C24H24ClN5S and a molecular weight of 450.01 g/mol. Its IUPAC name is 5-(8-chloroquinolin-6-yl)-3-(diethylaminomethylsulfanyl)-6-phenylpyrazin-2-amine.
| Compound Name | 5-(8-chloroquinolin-6-yl)-3-(diethylaminomethylsulfanyl)-6-phenylpyrazin-2-amine |
|---|---|
| PubChem CID | 137430405 |
| Molecular Formula | C24H24ClN5S |
| Molecular Weight | 450.01 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 5-(8-chloroquinolin-6-yl)-3-(diethylaminomethylsulfanyl)-6-phenylpyrazin-2-amine |
| SMILES | CCN(CC)CSc1nc(-c2cc(Cl)c3ncccc3c2)c(-c2ccccc2)nc1N |
| InChI | InChI=1S/C24H24ClN5S/c1-3-30(4-2)15-31-24-23(26)28-21(16-9-6-5-7-10-16)22(29-24)18-13-17-11-8-12-27-20(17)19(25)14-18/h5-14H,3-4,15H2,1-2H3,(H2,26,28) |
| InChIKey | KXLMXFOKTQBYMG-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.01 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|