C21H17N3O4S — CID 1374306
methyl 2-[[2-(3-cyano-7-methoxyquinolin-2-yl)sulfanylacetyl]amino]benzoate (PubChem CID 1374306) has the molecular formula C21H17N3O4S and a molecular weight of 407.45 g/mol. Its IUPAC name is methyl 2-[[2-(3-cyano-7-methoxyquinolin-2-yl)sulfanylacetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-(3-cyano-7-methoxyquinolin-2-yl)sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 1374306 |
| Molecular Formula | C21H17N3O4S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | methyl 2-[[2-(3-cyano-7-methoxyquinolin-2-yl)sulfanylacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)CSc1nc2cc(OC)ccc2cc1C#N |
| InChI | InChI=1S/C21H17N3O4S/c1-27-15-8-7-13-9-14(11-22)20(24-18(13)10-15)29-12-19(25)23-17-6-4-3-5-16(17)21(26)28-2/h3-10H,12H2,1-2H3,(H,23,25) |
| InChIKey | GNDDGCADFHZEPY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |