C18H19N3O3S — CID 3780179
2-(3-cyano-7-methoxyquinolin-2-yl)sulfanyl-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 3780179) has the molecular formula C18H19N3O3S and a molecular weight of 357.44 g/mol. Its IUPAC name is 2-(3-cyano-7-methoxyquinolin-2-yl)sulfanyl-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-(3-cyano-7-methoxyquinolin-2-yl)sulfanyl-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 3780179 |
| Molecular Formula | C18H19N3O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 2-(3-cyano-7-methoxyquinolin-2-yl)sulfanyl-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | COc1ccc2cc(C#N)c(SCC(=O)NCC3CCCO3)nc2c1 |
| InChI | InChI=1S/C18H19N3O3S/c1-23-14-5-4-12-7-13(9-19)18(21-16(12)8-14)25-11-17(22)20-10-15-3-2-6-24-15/h4-5,7-8,15H,2-3,6,10-11H2,1H3,(H,20,22) |
| InChIKey | FHBOJPWKAIWOPI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |