C23H22ClN5S — CID 137430826
5-(7-chloro-1H-indazol-5-yl)-3-cyclohexylsulfanyl-6-phenylpyrazin-2-amine (PubChem CID 137430826) has the molecular formula C23H22ClN5S and a molecular weight of 435.98 g/mol. Its IUPAC name is 5-(7-chloro-1H-indazol-5-yl)-3-cyclohexylsulfanyl-6-phenylpyrazin-2-amine.
| Compound Name | 5-(7-chloro-1H-indazol-5-yl)-3-cyclohexylsulfanyl-6-phenylpyrazin-2-amine |
|---|---|
| PubChem CID | 137430826 |
| Molecular Formula | C23H22ClN5S |
| Molecular Weight | 435.98 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 5-(7-chloro-1H-indazol-5-yl)-3-cyclohexylsulfanyl-6-phenylpyrazin-2-amine |
| SMILES | Nc1nc(-c2ccccc2)c(-c2cc(Cl)c3[nH]ncc3c2)nc1SC1CCCCC1 |
| InChI | InChI=1S/C23H22ClN5S/c24-18-12-15(11-16-13-26-29-19(16)18)21-20(14-7-3-1-4-8-14)27-22(25)23(28-21)30-17-9-5-2-6-10-17/h1,3-4,7-8,11-13,17H,2,5-6,9-10H2,(H2,25,27)(H,26,29) |
| InChIKey | REYHTKMCEWKYTE-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.98 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |