C17H12ClN5O — CID 137430965
3-amino-6-(7-chloro-1H-indazol-5-yl)-5-phenyl-1H-pyrazin-2-one (PubChem CID 137430965) has the molecular formula C17H12ClN5O and a molecular weight of 337.77 g/mol. Its IUPAC name is 3-amino-6-(7-chloro-1H-indazol-5-yl)-5-phenyl-1H-pyrazin-2-one.
| Compound Name | 3-amino-6-(7-chloro-1H-indazol-5-yl)-5-phenyl-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 137430965 |
| Molecular Formula | C17H12ClN5O |
| Molecular Weight | 337.77 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 3-amino-6-(7-chloro-1H-indazol-5-yl)-5-phenyl-1H-pyrazin-2-one |
| SMILES | Nc1nc(-c2ccccc2)c(-c2cc(Cl)c3[nH]ncc3c2)[nH]c1=O |
| InChI | InChI=1S/C17H12ClN5O/c18-12-7-10(6-11-8-20-23-13(11)12)15-14(9-4-2-1-3-5-9)21-16(19)17(24)22-15/h1-8H,(H2,19,21)(H,20,23)(H,22,24) |
| InChIKey | AYSVINKXJHMZDV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.77 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |