C22H18ClN5O — CID 137430504
6-(7-chloro-1H-indazol-5-yl)-3-(pent-3-yn-2-ylamino)-5-phenyl-1H-pyrazin-2-one (PubChem CID 137430504) has the molecular formula C22H18ClN5O and a molecular weight of 403.87 g/mol. Its IUPAC name is 6-(7-chloro-1H-indazol-5-yl)-3-(pent-3-yn-2-ylamino)-5-phenyl-1H-pyrazin-2-one.
| Compound Name | 6-(7-chloro-1H-indazol-5-yl)-3-(pent-3-yn-2-ylamino)-5-phenyl-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 137430504 |
| Molecular Formula | C22H18ClN5O |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 6-(7-chloro-1H-indazol-5-yl)-3-(pent-3-yn-2-ylamino)-5-phenyl-1H-pyrazin-2-one |
| SMILES | CC#CC(C)Nc1nc(-c2ccccc2)c(-c2cc(Cl)c3[nH]ncc3c2)[nH]c1=O |
| InChI | InChI=1S/C22H18ClN5O/c1-3-7-13(2)25-21-22(29)27-20(19(26-21)14-8-5-4-6-9-14)15-10-16-12-24-28-18(16)17(23)11-15/h4-6,8-13H,1-2H3,(H,24,28)(H,25,26)(H,27,29) |
| InChIKey | HJEKLBRKOMFAMD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|