C22H15ClN4O — CID 137438636
6-(7-chloro-1H-indazol-5-yl)-3-methyl-7-phenyl-1H-1,8-naphthyridin-2-one (PubChem CID 137438636) has the molecular formula C22H15ClN4O and a molecular weight of 386.84 g/mol. Its IUPAC name is 6-(7-chloro-1H-indazol-5-yl)-3-methyl-7-phenyl-1H-1,8-naphthyridin-2-one.
| Compound Name | 6-(7-chloro-1H-indazol-5-yl)-3-methyl-7-phenyl-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 137438636 |
| Molecular Formula | C22H15ClN4O |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 6-(7-chloro-1H-indazol-5-yl)-3-methyl-7-phenyl-1H-1,8-naphthyridin-2-one |
| SMILES | Cc1cc2cc(-c3cc(Cl)c4[nH]ncc4c3)c(-c3ccccc3)nc2[nH]c1=O |
| InChI | InChI=1S/C22H15ClN4O/c1-12-7-15-9-17(14-8-16-11-24-27-20(16)18(23)10-14)19(13-5-3-2-4-6-13)25-21(15)26-22(12)28/h2-11H,1H3,(H,24,27)(H,25,26,28) |
| InChIKey | WTHITJOMXTYZSJ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |