C14H11ClN2 — CID 171662369
7-chloro-5-(2-methylphenyl)-1H-indazole (PubChem CID 171662369) has the molecular formula C14H11ClN2 and a molecular weight of 242.71 g/mol. Its IUPAC name is 7-chloro-5-(2-methylphenyl)-1H-indazole.
| Compound Name | 7-chloro-5-(2-methylphenyl)-1H-indazole |
|---|---|
| PubChem CID | 171662369 |
| Molecular Formula | C14H11ClN2 |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 7-chloro-5-(2-methylphenyl)-1H-indazole |
| SMILES | Cc1ccccc1-c1cc(Cl)c2[nH]ncc2c1 |
| InChI | InChI=1S/C14H11ClN2/c1-9-4-2-3-5-12(9)10-6-11-8-16-17-14(11)13(15)7-10/h2-8H,1H3,(H,16,17) |
| InChIKey | VTACZSSLMDMPJK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |