C23H17ClN4O — CID 137438412
6-(7-chloro-1H-indazol-5-yl)-4-ethyl-7-phenyl-1H-1,8-naphthyridin-2-one (PubChem CID 137438412) has the molecular formula C23H17ClN4O and a molecular weight of 400.87 g/mol. Its IUPAC name is 6-(7-chloro-1H-indazol-5-yl)-4-ethyl-7-phenyl-1H-1,8-naphthyridin-2-one.
| Compound Name | 6-(7-chloro-1H-indazol-5-yl)-4-ethyl-7-phenyl-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 137438412 |
| Molecular Formula | C23H17ClN4O |
| Molecular Weight | 400.87 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 6-(7-chloro-1H-indazol-5-yl)-4-ethyl-7-phenyl-1H-1,8-naphthyridin-2-one |
| SMILES | CCc1cc(=O)[nH]c2nc(-c3ccccc3)c(-c3cc(Cl)c4[nH]ncc4c3)cc12 |
| InChI | InChI=1S/C23H17ClN4O/c1-2-13-10-20(29)26-23-18(13)11-17(21(27-23)14-6-4-3-5-7-14)15-8-16-12-25-28-22(16)19(24)9-15/h3-12H,2H2,1H3,(H,25,28)(H,26,27,29) |
| InChIKey | SFMYCJIONLEGKK-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.87 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |