C21H12Cl2N4O — CID 137438644
4-chloro-6-(7-chloro-1H-indazol-5-yl)-7-phenyl-1H-1,8-naphthyridin-2-one (PubChem CID 137438644) has the molecular formula C21H12Cl2N4O and a molecular weight of 407.26 g/mol. Its IUPAC name is 4-chloro-6-(7-chloro-1H-indazol-5-yl)-7-phenyl-1H-1,8-naphthyridin-2-one.
| Compound Name | 4-chloro-6-(7-chloro-1H-indazol-5-yl)-7-phenyl-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 137438644 |
| Molecular Formula | C21H12Cl2N4O |
| Molecular Weight | 407.26 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | 4-chloro-6-(7-chloro-1H-indazol-5-yl)-7-phenyl-1H-1,8-naphthyridin-2-one |
| SMILES | O=c1cc(Cl)c2cc(-c3cc(Cl)c4[nH]ncc4c3)c(-c3ccccc3)nc2[nH]1 |
| InChI | InChI=1S/C21H12Cl2N4O/c22-16-9-18(28)25-21-15(16)8-14(19(26-21)11-4-2-1-3-5-11)12-6-13-10-24-27-20(13)17(23)7-12/h1-10H,(H,24,27)(H,25,26,28) |
| InChIKey | KKLZTGVVTIGQIO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.26 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |