C24H25ClN6O — CID 137431266
5-(8-chloroquinolin-6-yl)-3-(cyclohexylmethoxy)-6-(1-methylpyrazol-3-yl)pyrazin-2-amine (PubChem CID 137431266) has the molecular formula C24H25ClN6O and a molecular weight of 448.96 g/mol. Its IUPAC name is 5-(8-chloroquinolin-6-yl)-3-(cyclohexylmethoxy)-6-(1-methylpyrazol-3-yl)pyrazin-2-amine.
| Compound Name | 5-(8-chloroquinolin-6-yl)-3-(cyclohexylmethoxy)-6-(1-methylpyrazol-3-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 137431266 |
| Molecular Formula | C24H25ClN6O |
| Molecular Weight | 448.96 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 5-(8-chloroquinolin-6-yl)-3-(cyclohexylmethoxy)-6-(1-methylpyrazol-3-yl)pyrazin-2-amine |
| SMILES | Cn1ccc(-c2nc(N)c(OCC3CCCCC3)nc2-c2cc(Cl)c3ncccc3c2)n1 |
| InChI | InChI=1S/C24H25ClN6O/c1-31-11-9-19(30-31)22-21(17-12-16-8-5-10-27-20(16)18(25)13-17)29-24(23(26)28-22)32-14-15-6-3-2-4-7-15/h5,8-13,15H,2-4,6-7,14H2,1H3,(H2,26,28) |
| InChIKey | YDTVZIFEEKLALX-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.96 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |