C19H25N5O3 — CID 137439485
methyl N-[4-[3-[4-ethanimidoyl-3-(methylamino)phenyl]-1,2,4-oxadiazol-5-yl]cyclohexyl]carbamate (PubChem CID 137439485) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is methyl N-[4-[3-[4-ethanimidoyl-3-(methylamino)phenyl]-1,2,4-oxadiazol-5-yl]cyclohexyl]carbamate.
| Compound Name | methyl N-[4-[3-[4-ethanimidoyl-3-(methylamino)phenyl]-1,2,4-oxadiazol-5-yl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 137439485 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | methyl N-[4-[3-[4-ethanimidoyl-3-(methylamino)phenyl]-1,2,4-oxadiazol-5-yl]cyclohexyl]carbamate |
| SMILES | [H]/N=C(\C)c1ccc(-c2noc(C3CCC(NC(=O)OC)CC3)n2)cc1NC |
| InChI | InChI=1S/C19H25N5O3/c1-11(20)15-9-6-13(10-16(15)21-2)17-23-18(27-24-17)12-4-7-14(8-5-12)22-19(25)26-3/h6,9-10,12,14,20-21H,4-5,7-8H2,1-3H3,(H,22,25)/b20-11+ |
| InChIKey | UYJNJNMGSSJRPR-RGVLZGJSSA-N |
| XLogP | 3.55 |
| TPSA | 113.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|