C26H31F2N3O2 — CID 137440135
3-[[(1R)-1-[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]-2,2-dimethylpropyl]amino]propyl carbamate (PubChem CID 137440135) has the molecular formula C26H31F2N3O2 and a molecular weight of 455.55 g/mol. Its IUPAC name is 3-[[(1R)-1-[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]-2,2-dimethylpropyl]amino]propyl carbamate.
| Compound Name | 3-[[(1R)-1-[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]-2,2-dimethylpropyl]amino]propyl carbamate |
|---|---|
| PubChem CID | 137440135 |
| Molecular Formula | C26H31F2N3O2 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | 3-[[(1R)-1-[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]-2,2-dimethylpropyl]amino]propyl carbamate |
| SMILES | CC(C)(C)[C@@H](NCCCOC(N)=O)c1cc(-c2cc(F)ccc2F)cn1Cc1ccccc1 |
| InChI | InChI=1S/C26H31F2N3O2/c1-26(2,3)24(30-12-7-13-33-25(29)32)23-14-19(21-15-20(27)10-11-22(21)28)17-31(23)16-18-8-5-4-6-9-18/h4-6,8-11,14-15,17,24,30H,7,12-13,16H2,1-3H3,(H2,29,32)/t24-/m0/s1 |
| InChIKey | VYGMRYJBSFNUTQ-DEOSSOPVSA-N |
| XLogP | 5.64 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|