C41H42F2N2O2 — CID 149220078
9H-fluoren-9-ylmethyl 5-[[(1R)-1-[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]-2,2-dimethylpropyl]amino]pentanoate (PubChem CID 149220078) has the molecular formula C41H42F2N2O2 and a molecular weight of 632.80 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 5-[[(1R)-1-[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]-2,2-dimethylpropyl]amino]pentanoate.
| Compound Name | 9H-fluoren-9-ylmethyl 5-[[(1R)-1-[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]-2,2-dimethylpropyl]amino]pentanoate |
|---|---|
| PubChem CID | 149220078 |
| Molecular Formula | C41H42F2N2O2 |
| Molecular Weight | 632.80 g/mol |
| Exact Mass | 632.32 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 5-[[(1R)-1-[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]-2,2-dimethylpropyl]amino]pentanoate |
| SMILES | CC(C)(C)[C@@H](NCCCCC(=O)OCC1c2ccccc2-c2ccccc21)c1cc(-c2cc(F)ccc2F)cn1Cc1ccccc1 |
| InChI | InChI=1S/C41H42F2N2O2/c1-41(2,3)40(38-23-29(35-24-30(42)20-21-37(35)43)26-45(38)25-28-13-5-4-6-14-28)44-22-12-11-19-39(46)47-27-36-33-17-9-7-15-31(33)32-16-8-10-18-34(32)36/h4-10,13-18,20-21,23-24,26,36,40,44H,11-12,19,22,25,27H2,1-3H3/t40-/m0/s1 |
| InChIKey | XIGRQGAIJASJEH-FAIXQHPJSA-N |
| XLogP | 9.68 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.80 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|